C18H25FO4 — CID 57198928
ethyl 2-[2-(4-fluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate (PubChem CID 57198928) has the molecular formula C18H25FO4 and a molecular weight of 324.39 g/mol. Its IUPAC name is ethyl 2-[2-(4-fluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate.
| Compound Name | ethyl 2-[2-(4-fluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 57198928 |
| Molecular Formula | C18H25FO4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | ethyl 2-[2-(4-fluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate |
| SMILES | CCOC(=O)C(CCc1ccc(F)cc1)C(=O)CC(O)C(C)C |
| InChI | InChI=1S/C18H25FO4/c1-4-23-18(22)15(17(21)11-16(20)12(2)3)10-7-13-5-8-14(19)9-6-13/h5-6,8-9,12,15-16,20H,4,7,10-11H2,1-3H3 |
| InChIKey | DFUNSAHTNMBPPF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|