C26H42N2O3 — CID 57200714
(8S,9R,10R,13S,14S)-4-acetamido-N-tert-butyl-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxamide (PubChem CID 57200714) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-4-acetamido-N-tert-butyl-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxamide.
| Compound Name | (8S,9R,10R,13S,14S)-4-acetamido-N-tert-butyl-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxamide |
|---|---|
| PubChem CID | 57200714 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | (8S,9R,10R,13S,14S)-4-acetamido-N-tert-butyl-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxamide |
| SMILES | CC(=O)NC1(C(=O)NC(C)(C)C)C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C26H42N2O3/c1-16(29)27-26(22(31)28-23(2,3)4)20-10-9-17-18-8-7-13-24(18,5)14-11-19(17)25(20,6)15-12-21(26)30/h17-20H,7-15H2,1-6H3,(H,27,29)(H,28,31)/t17-,18-,19+,20?,24-,25+,26?/m0/s1 |
| InChIKey | ATUMOFYFYKPJGQ-ZEGYKKHSSA-N |
| XLogP | 4.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|