C14H12N2O2S — CID 57201557
3,4,9-trimethylthiochromeno[4,3-c]pyrazole-8-carboxylic acid (PubChem CID 57201557) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 3,4,9-trimethylthiochromeno[4,3-c]pyrazole-8-carboxylic acid.
| Compound Name | 3,4,9-trimethylthiochromeno[4,3-c]pyrazole-8-carboxylic acid |
|---|---|
| PubChem CID | 57201557 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3,4,9-trimethylthiochromeno[4,3-c]pyrazole-8-carboxylic acid |
| SMILES | Cc1nnc2c3c(C)c(C(=O)O)ccc3sc(C)c1-2 |
| InChI | InChI=1S/C14H12N2O2S/c1-6-9(14(17)18)4-5-10-11(6)13-12(8(3)19-10)7(2)15-16-13/h4-5H,1-3H3,(H,17,18) |
| InChIKey | NCKMFPWKDMKPOP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |