C24H28Br2O4 — CID 57201648
3,3-dibromo-2-hydroxy-2,4-bis[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid (PubChem CID 57201648) has the molecular formula C24H28Br2O4 and a molecular weight of 540.29 g/mol. Its IUPAC name is 3,3-dibromo-2-hydroxy-2,4-bis[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 3,3-dibromo-2-hydroxy-2,4-bis[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57201648 |
| Molecular Formula | C24H28Br2O4 |
| Molecular Weight | 540.29 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 3,3-dibromo-2-hydroxy-2,4-bis[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid |
| SMILES | CC(C)Cc1ccc(C(=O)C(Br)(Br)C(O)(C(=O)O)c2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H28Br2O4/c1-15(2)13-17-5-9-19(10-6-17)21(27)24(25,26)23(30,22(28)29)20-11-7-18(8-12-20)14-16(3)4/h5-12,15-16,30H,13-14H2,1-4H3,(H,28,29) |
| InChIKey | AZBBYPHRNLCHJR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.29 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|