C17H22O4 — CID 57205162
2-[(1R,2S,5S)-2-hydroxy-5-(4-phenylbutanoyl)cyclopentyl]acetic acid (PubChem CID 57205162) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[(1R,2S,5S)-2-hydroxy-5-(4-phenylbutanoyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S,5S)-2-hydroxy-5-(4-phenylbutanoyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 57205162 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(1R,2S,5S)-2-hydroxy-5-(4-phenylbutanoyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(=O)CCCc2ccccc2)CC[C@@H]1O |
| InChI | InChI=1S/C17H22O4/c18-15(8-4-7-12-5-2-1-3-6-12)13-9-10-16(19)14(13)11-17(20)21/h1-3,5-6,13-14,16,19H,4,7-11H2,(H,20,21)/t13-,14+,16-/m0/s1 |
| InChIKey | MWBKVOLVDHGIGX-LZWOXQAQSA-N |
| XLogP | 2.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |