C17H14N2O4 — CID 57207206
phenyl 2-[(5-methyl-4-oxo-3,1-benzoxazin-2-yl)amino]acetate (PubChem CID 57207206) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is phenyl 2-[(5-methyl-4-oxo-3,1-benzoxazin-2-yl)amino]acetate.
| Compound Name | phenyl 2-[(5-methyl-4-oxo-3,1-benzoxazin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 57207206 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | phenyl 2-[(5-methyl-4-oxo-3,1-benzoxazin-2-yl)amino]acetate |
| SMILES | Cc1cccc2nc(NCC(=O)Oc3ccccc3)oc(=O)c12 |
| InChI | InChI=1S/C17H14N2O4/c1-11-6-5-9-13-15(11)16(21)23-17(19-13)18-10-14(20)22-12-7-3-2-4-8-12/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | MVVUWTQVFNFFFE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|