C10H10N4 — CID 57209093
13-methyl-4,5,7,13-tetrazatricyclo[8.3.0.03,7]trideca-1,3,5,8,10-pentaene (PubChem CID 57209093) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 13-methyl-4,5,7,13-tetrazatricyclo[8.3.0.03,7]trideca-1,3,5,8,10-pentaene.
| Compound Name | 13-methyl-4,5,7,13-tetrazatricyclo[8.3.0.03,7]trideca-1,3,5,8,10-pentaene |
|---|---|
| PubChem CID | 57209093 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 13-methyl-4,5,7,13-tetrazatricyclo[8.3.0.03,7]trideca-1,3,5,8,10-pentaene |
| SMILES | CN1CC=C2C=Cn3cnnc3C=C21 |
| InChI | InChI=1S/C10H10N4/c1-13-4-2-8-3-5-14-7-11-12-10(14)6-9(8)13/h2-3,5-7H,4H2,1H3 |
| InChIKey | CEWYHQWQKCTXSF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |