C31H40N2O2S — CID 57209508
N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-2-phenyl-2-thiophen-3-ylacetamide (PubChem CID 57209508) has the molecular formula C31H40N2O2S and a molecular weight of 504.74 g/mol. Its IUPAC name is N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-2-phenyl-2-thiophen-3-ylacetamide.
| Compound Name | N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-2-phenyl-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 57209508 |
| Molecular Formula | C31H40N2O2S |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-2-phenyl-2-thiophen-3-ylacetamide |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(NC(=O)C(c3ccccc3)c3ccsc3)CC[C@@H]12 |
| InChI | InChI=1S/C31H40N2O2S/c1-30-16-13-24-22(9-12-26-31(24,2)17-14-27(34)33(26)3)23(30)10-11-25(30)32-29(35)28(21-15-18-36-19-21)20-7-5-4-6-8-20/h4-8,15,18-19,22-26,28H,9-14,16-17H2,1-3H3,(H,32,35)/t22-,23-,24+,25?,26?,28?,30-,31+/m0/s1 |
| InChIKey | QADLUVBWKDVNOZ-AKHRUWPDSA-N |
| XLogP | 6.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |