C29H41N3O5 — CID 67724086
N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-4-(2-nitrophenoxy)butanamide (PubChem CID 67724086) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-4-(2-nitrophenoxy)butanamide.
| Compound Name | N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-4-(2-nitrophenoxy)butanamide |
|---|---|
| PubChem CID | 67724086 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | N-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-4-(2-nitrophenoxy)butanamide |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(NC(=O)CCCOc3ccccc3[N+](=O)[O-])CC[C@@H]12 |
| InChI | InChI=1S/C29H41N3O5/c1-28-16-14-21-19(10-13-25-29(21,2)17-15-27(34)31(25)3)20(28)11-12-24(28)30-26(33)9-6-18-37-23-8-5-4-7-22(23)32(35)36/h4-5,7-8,19-21,24-25H,6,9-18H2,1-3H3,(H,30,33)/t19-,20-,21+,24?,25?,28-,29+/m0/s1 |
| InChIKey | RNUQJAYNVXIMOU-YANADRTRSA-N |
| XLogP | 5.10 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|