C24H41N3O2 — CID 57221987
1-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-tert-butylurea (PubChem CID 57221987) has the molecular formula C24H41N3O2 and a molecular weight of 403.61 g/mol. Its IUPAC name is 1-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-tert-butylurea.
| Compound Name | 1-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-tert-butylurea |
|---|---|
| PubChem CID | 57221987 |
| Molecular Formula | C24H41N3O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | 1-[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-tert-butylurea |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(NC(=O)NC(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C24H41N3O2/c1-22(2,3)26-21(29)25-18-9-8-16-15-7-10-19-24(5,14-12-20(28)27(19)6)17(15)11-13-23(16,18)4/h15-19H,7-14H2,1-6H3,(H2,25,26,29)/t15-,16-,17+,18?,19?,23-,24+/m0/s1 |
| InChIKey | AIHLDWVMLUOUTP-VCKBVTCQSA-N |
| XLogP | 4.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |