C41H59N3O8S2 — CID 57211404
[1-[(4-methylphenyl)sulfonyl-octylamino]-2-oxo-2-(phenylmethoxyamino)ethyl] 2-[(4-methylphenyl)sulfonyl-octylamino]acetate (PubChem CID 57211404) has the molecular formula C41H59N3O8S2 and a molecular weight of 786.07 g/mol. Its IUPAC name is [1-[(4-methylphenyl)sulfonyl-octylamino]-2-oxo-2-(phenylmethoxyamino)ethyl] 2-[(4-methylphenyl)sulfonyl-octylamino]acetate.
| Compound Name | [1-[(4-methylphenyl)sulfonyl-octylamino]-2-oxo-2-(phenylmethoxyamino)ethyl] 2-[(4-methylphenyl)sulfonyl-octylamino]acetate |
|---|---|
| PubChem CID | 57211404 |
| Molecular Formula | C41H59N3O8S2 |
| Molecular Weight | 786.07 g/mol |
| Exact Mass | 785.37 |
| IUPAC Name | [1-[(4-methylphenyl)sulfonyl-octylamino]-2-oxo-2-(phenylmethoxyamino)ethyl] 2-[(4-methylphenyl)sulfonyl-octylamino]acetate |
| SMILES | CCCCCCCCN(CC(=O)OC(C(=O)NOCc1ccccc1)N(CCCCCCCC)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C41H59N3O8S2/c1-5-7-9-11-13-18-30-43(53(47,48)37-26-22-34(3)23-27-37)32-39(45)52-41(40(46)42-51-33-36-20-16-15-17-21-36)44(31-19-14-12-10-8-6-2)54(49,50)38-28-24-35(4)25-29-38/h15-17,20-29,41H,5-14,18-19,30-33H2,1-4H3,(H,42,46) |
| InChIKey | HCYPZPZWCWWVMA-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.07 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|