C12H8N4O4 — CID 57212447
6-(2-nitrophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 57212447) has the molecular formula C12H8N4O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 6-(2-nitrophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-(2-nitrophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 57212447 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-(2-nitrophenoxy)-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2cc(Oc3ccccc3[N+](=O)[O-])cnc2[nH]1 |
| InChI | InChI=1S/C12H8N4O4/c17-12-14-8-5-7(6-13-11(8)15-12)20-10-4-2-1-3-9(10)16(18)19/h1-6H,(H2,13,14,15,17) |
| InChIKey | CGXQACFHEXFREX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|