C40H65NO3 — CID 57214149
ethyl N-[2,3,5,6-tetrapentyl-4-(3-pentylphenoxy)phenyl]carbamate (PubChem CID 57214149) has the molecular formula C40H65NO3 and a molecular weight of 607.96 g/mol. Its IUPAC name is ethyl N-[2,3,5,6-tetrapentyl-4-(3-pentylphenoxy)phenyl]carbamate.
| Compound Name | ethyl N-[2,3,5,6-tetrapentyl-4-(3-pentylphenoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 57214149 |
| Molecular Formula | C40H65NO3 |
| Molecular Weight | 607.96 g/mol |
| Exact Mass | 607.50 |
| IUPAC Name | ethyl N-[2,3,5,6-tetrapentyl-4-(3-pentylphenoxy)phenyl]carbamate |
| SMILES | CCCCCc1cccc(Oc2c(CCCCC)c(CCCCC)c(NC(=O)OCC)c(CCCCC)c2CCCCC)c1 |
| InChI | InChI=1S/C40H65NO3/c1-7-13-18-24-32-25-23-26-33(31-32)44-39-36(29-21-16-10-4)34(27-19-14-8-2)38(41-40(42)43-12-6)35(28-20-15-9-3)37(39)30-22-17-11-5/h23,25-26,31H,7-22,24,27-30H2,1-6H3,(H,41,42) |
| InChIKey | OMQKWVXECWWURU-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.96 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|