C19H26O8 — CID 57215206
4-[5-(4-carboxypent-4-enoxycarbonyl)hex-5-en-2-yloxycarbonyl]pent-4-enoic acid (PubChem CID 57215206) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-[5-(4-carboxypent-4-enoxycarbonyl)hex-5-en-2-yloxycarbonyl]pent-4-enoic acid.
| Compound Name | 4-[5-(4-carboxypent-4-enoxycarbonyl)hex-5-en-2-yloxycarbonyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 57215206 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-[5-(4-carboxypent-4-enoxycarbonyl)hex-5-en-2-yloxycarbonyl]pent-4-enoic acid |
| SMILES | C=C(CCCOC(=O)C(=C)CCC(C)OC(=O)C(=C)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26O8/c1-12(17(22)23)6-5-11-26-18(24)13(2)7-9-15(4)27-19(25)14(3)8-10-16(20)21/h15H,1-3,5-11H2,4H3,(H,20,21)(H,22,23) |
| InChIKey | GJQKUDJZWWZAEN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|