C12H12Cl2O3 — CID 57217478
[2,2-dichloro-1-(4-ethoxyphenyl)cyclopropyl] formate (PubChem CID 57217478) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is [2,2-dichloro-1-(4-ethoxyphenyl)cyclopropyl] formate.
| Compound Name | [2,2-dichloro-1-(4-ethoxyphenyl)cyclopropyl] formate |
|---|---|
| PubChem CID | 57217478 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | [2,2-dichloro-1-(4-ethoxyphenyl)cyclopropyl] formate |
| SMILES | CCOc1ccc(C2(OC=O)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H12Cl2O3/c1-2-16-10-5-3-9(4-6-10)11(17-8-15)7-12(11,13)14/h3-6,8H,2,7H2,1H3 |
| InChIKey | ROJKVIBQGGENCP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|