C13H12F4O3 — CID 88627301
[(1S)-1-(4-ethoxyphenyl)-2,2,3,3-tetrafluorocyclobutyl] formate (PubChem CID 88627301) has the molecular formula C13H12F4O3 and a molecular weight of 292.23 g/mol. Its IUPAC name is [(1S)-1-(4-ethoxyphenyl)-2,2,3,3-tetrafluorocyclobutyl] formate.
| Compound Name | [(1S)-1-(4-ethoxyphenyl)-2,2,3,3-tetrafluorocyclobutyl] formate |
|---|---|
| PubChem CID | 88627301 |
| Molecular Formula | C13H12F4O3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [(1S)-1-(4-ethoxyphenyl)-2,2,3,3-tetrafluorocyclobutyl] formate |
| SMILES | CCOc1ccc([C@@]2(OC=O)CC(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C13H12F4O3/c1-2-19-10-5-3-9(4-6-10)11(20-8-18)7-12(14,15)13(11,16)17/h3-6,8H,2,7H2,1H3/t11-/m0/s1 |
| InChIKey | QRUDWWVYDMUBEV-NSHDSACASA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|