C15H9NO — CID 57220812
5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,7,9,12,15-heptaen-6-one (PubChem CID 57220812) has the molecular formula C15H9NO and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,7,9,12,15-heptaen-6-one.
| Compound Name | 5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,7,9,12,15-heptaen-6-one |
|---|---|
| PubChem CID | 57220812 |
| Molecular Formula | C15H9NO |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,7,9,12,15-heptaen-6-one |
| SMILES | O=C1C=C2C=CC3C=CC=c4ccc(c2c43)=N1 |
| InChI | InChI=1S/C15H9NO/c17-13-8-11-5-4-9-2-1-3-10-6-7-12(16-13)15(11)14(9)10/h1-9H |
| InChIKey | LSJJWLQDXOKRJJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |