C18H17NO2 — CID 57221647
(4,5-dibenzyl-1,2-oxazol-3-yl)methanol (PubChem CID 57221647) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (4,5-dibenzyl-1,2-oxazol-3-yl)methanol.
| Compound Name | (4,5-dibenzyl-1,2-oxazol-3-yl)methanol |
|---|---|
| PubChem CID | 57221647 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (4,5-dibenzyl-1,2-oxazol-3-yl)methanol |
| SMILES | OCc1noc(Cc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c20-13-17-16(11-14-7-3-1-4-8-14)18(21-19-17)12-15-9-5-2-6-10-15/h1-10,20H,11-13H2 |
| InChIKey | WWSYGZFQUDKHCF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |