About 3-amino-5-benzyl-1,2-oxazole-4-carboxamide
3-amino-5-benzyl-1,2-oxazole-4-carboxamide (PubChem CID 110171439) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-amino-5-benzyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-benzyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 110171439 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-amino-5-benzyl-1,2-oxazole-4-carboxamide |
| SMILES | NC(=O)c1c(N)noc1Cc1ccccc1 |
| InChI | InChI=1S/C11H11N3O2/c12-10-9(11(13)15)8(16-14-10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,12,14)(H2,13,15) |
| InChIKey | XNSMHPBHIZYITK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-benzyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-benzyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-amino-5-benzyl-1,2-oxazole-4-carboxamide (CID 110171439) is 3-amino-5-benzyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-amino-5-benzyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-amino-5-benzyl-1,2-oxazole-4-carboxamide is NC(=O)c1c(N)noc1Cc1ccccc1.
What is the InChIKey of 3-amino-5-benzyl-1,2-oxazole-4-carboxamide?
The InChIKey is XNSMHPBHIZYITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c12-10-9(11(13)15)8(16-14-10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,12,14)(H2,13,15).
What are the key properties of 3-amino-5-benzyl-1,2-oxazole-4-carboxamide?
3-amino-5-benzyl-1,2-oxazole-4-carboxamide has a molecular weight of 217.23 g/mol, XLogP of 0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-benzyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 110171439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).