C12H13N5O2 — CID 16792148
2,4-diamino-6-phenylmethoxypyrimidine-5-carboxamide (PubChem CID 16792148) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2,4-diamino-6-phenylmethoxypyrimidine-5-carboxamide.
| Compound Name | 2,4-diamino-6-phenylmethoxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 16792148 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2,4-diamino-6-phenylmethoxypyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c(N)nc(N)nc1OCc1ccccc1 |
| InChI | InChI=1S/C12H13N5O2/c13-9-8(10(14)18)11(17-12(15)16-9)19-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,14,18)(H4,13,15,16,17) |
| InChIKey | XXQDCJYEDVKRAL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |