C24H22N2O2 — CID 57224207
2-[4-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxybenzenecarboximidoyl cyanide (PubChem CID 57224207) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxybenzenecarboximidoyl cyanide.
| Compound Name | 2-[4-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxybenzenecarboximidoyl cyanide |
|---|---|
| PubChem CID | 57224207 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[4-[(2,5-dimethylphenoxy)methyl]phenyl]-N-methoxybenzenecarboximidoyl cyanide |
| SMILES | CON=C(C#N)c1ccccc1-c1ccc(COc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-17-8-9-18(2)24(14-17)28-16-19-10-12-20(13-11-19)21-6-4-5-7-22(21)23(15-25)26-27-3/h4-14H,16H2,1-3H3 |
| InChIKey | ZARCLURVPGHOBD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|