C17H27ClO2 — CID 57224642
[(2S)-3,3-dimethyl-5-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]pent-4-en-2-yl] 2-chloroacetate (PubChem CID 57224642) has the molecular formula C17H27ClO2 and a molecular weight of 298.85 g/mol. Its IUPAC name is [(2S)-3,3-dimethyl-5-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]pent-4-en-2-yl] 2-chloroacetate.
| Compound Name | [(2S)-3,3-dimethyl-5-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]pent-4-en-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 57224642 |
| Molecular Formula | C17H27ClO2 |
| Molecular Weight | 298.85 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(2S)-3,3-dimethyl-5-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]pent-4-en-2-yl] 2-chloroacetate |
| SMILES | CC1=CC[C@H](C=CC(C)(C)[C@H](C)OC(=O)CCl)C1(C)C |
| InChI | InChI=1S/C17H27ClO2/c1-12-7-8-14(17(12,5)6)9-10-16(3,4)13(2)20-15(19)11-18/h7,9-10,13-14H,8,11H2,1-6H3/t13-,14+/m0/s1 |
| InChIKey | PIGWTZUNPYCTBE-UONOGXRCSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|