C23H32O2 — CID 7057536
[(E,3S)-4,4-dimethyl-6-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-5-en-3-yl] benzoate (PubChem CID 7057536) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is [(E,3S)-4,4-dimethyl-6-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-5-en-3-yl] benzoate.
| Compound Name | [(E,3S)-4,4-dimethyl-6-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 7057536 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [(E,3S)-4,4-dimethyl-6-[(1S)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-5-en-3-yl] benzoate |
| SMILES | CC[C@H](OC(=O)c1ccccc1)C(C)(C)/C=C/[C@@H]1CC=C(C)C1(C)C |
| InChI | InChI=1S/C23H32O2/c1-7-20(25-21(24)18-11-9-8-10-12-18)22(3,4)16-15-19-14-13-17(2)23(19,5)6/h8-13,15-16,19-20H,7,14H2,1-6H3/b16-15+/t19-,20-/m0/s1 |
| InChIKey | YFVLNVDXVHNQCT-LOVRKWTRSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|