C23H41N — CID 57225511
2,3-bis(1-butylcyclohexyl)propanenitrile (PubChem CID 57225511) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is 2,3-bis(1-butylcyclohexyl)propanenitrile.
| Compound Name | 2,3-bis(1-butylcyclohexyl)propanenitrile |
|---|---|
| PubChem CID | 57225511 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 2,3-bis(1-butylcyclohexyl)propanenitrile |
| SMILES | CCCCC1(CC(C#N)C2(CCCC)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C23H41N/c1-3-5-13-22(14-9-7-10-15-22)19-21(20-24)23(16-6-4-2)17-11-8-12-18-23/h21H,3-19H2,1-2H3 |
| InChIKey | NLKKUJFKEZVIKJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |