C28H44O3 — CID 57225755
(1R,3R,9R,10S,13R,14R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,2,3-triol (PubChem CID 57225755) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (1R,3R,9R,10S,13R,14R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,2,3-triol.
| Compound Name | (1R,3R,9R,10S,13R,14R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,2,3-triol |
|---|---|
| PubChem CID | 57225755 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (1R,3R,9R,10S,13R,14R,17R)-17-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,2,3-triol |
| SMILES | CC(C)[C@@H](C)C=C[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)C(O)[C@H](O)[C@@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C28H44O3/c1-16(2)17(3)7-8-18(4)21-11-12-22-20-10-9-19-15-24(29)25(30)26(31)28(19,6)23(20)13-14-27(21,22)5/h7-10,16-18,21-26,29-31H,11-15H2,1-6H3/t17-,18+,21+,22-,23+,24+,25?,26-,27+,28+/m0/s1 |
| InChIKey | JRJDEUDWPXNQFJ-HTMLSWGJSA-N |
| XLogP | 5.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|