About 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one
3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one (PubChem CID 57226033) has the molecular formula C24H27N3O2
and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one |
| PubChem CID | 57226033 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(C=C3C(=O)Nc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C24H27N3O2/c1-24(2,3)23(29)27-14-12-26(13-15-27)18-10-8-17(9-11-18)16-20-19-6-4-5-7-21(19)25-22(20)28/h4-11,16H,12-15H2,1-3H3,(H,25,28) |
| InChIKey | IRKOUTSPSXMOIQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one?
The IUPAC name of 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one (CID 57226033) is 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one.
What is the SMILES notation for 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one?
The canonical SMILES for 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one is CC(C)(C)C(=O)N1CCN(c2ccc(C=C3C(=O)Nc4ccccc43)cc2)CC1.
What is the InChIKey of 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one?
The InChIKey is IRKOUTSPSXMOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O2/c1-24(2,3)23(29)27-14-12-26(13-15-27)18-10-8-17(9-11-18)16-20-19-6-4-5-7-21(19)25-22(20)28/h4-11,16H,12-15H2,1-3H3,(H,25,28).
What are the key properties of 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one?
3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one has a molecular weight of 389.50 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]methylidene]-1H-indol-2-one is sourced from PubChem (CID 57226033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).