C20H43NO7PS+ — CID 57226090
[4-(decylsulfonylamino)-1-hydroxy-3-oxodecan-2-yl]-trihydroxyphosphanium (PubChem CID 57226090) has the molecular formula C20H43NO7PS+ and a molecular weight of 472.61 g/mol. Its IUPAC name is [4-(decylsulfonylamino)-1-hydroxy-3-oxodecan-2-yl]-trihydroxyphosphanium.
| Compound Name | [4-(decylsulfonylamino)-1-hydroxy-3-oxodecan-2-yl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57226090 |
| Molecular Formula | C20H43NO7PS+ |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [4-(decylsulfonylamino)-1-hydroxy-3-oxodecan-2-yl]-trihydroxyphosphanium |
| SMILES | CCCCCCCCCCS(=O)(=O)NC(CCCCCC)C(=O)C(CO)[P+](O)(O)O |
| InChI | InChI=1S/C20H43NO7PS/c1-3-5-7-9-10-11-12-14-16-30(27,28)21-18(15-13-8-6-4-2)20(23)19(17-22)29(24,25)26/h18-19,21-22,24-26H,3-17H2,1-2H3/q+1 |
| InChIKey | FNCCKMKPSNYPKB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|