C19H24ClN3O3 — CID 57227142
ethyl 1-[2-carbamoyl-3-(4-chlorophenyl)-3-methylbutyl]-5-methylimidazole-4-carboxylate (PubChem CID 57227142) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is ethyl 1-[2-carbamoyl-3-(4-chlorophenyl)-3-methylbutyl]-5-methylimidazole-4-carboxylate.
| Compound Name | ethyl 1-[2-carbamoyl-3-(4-chlorophenyl)-3-methylbutyl]-5-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 57227142 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 1-[2-carbamoyl-3-(4-chlorophenyl)-3-methylbutyl]-5-methylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn(CC(C(N)=O)C(C)(C)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C19H24ClN3O3/c1-5-26-18(25)16-12(2)23(11-22-16)10-15(17(21)24)19(3,4)13-6-8-14(20)9-7-13/h6-9,11,15H,5,10H2,1-4H3,(H2,21,24) |
| InChIKey | NYRHDPQHOBUZKI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |