C20H22O26P2 — CID 57228678
1-[4-oxo-4-(1,2,3,4-tetracarboxy-1-phosphonobutoxy)but-2-enoyl]oxy-1-phosphonobutane-1,2,3,4-tetracarboxylic acid (PubChem CID 57228678) has the molecular formula C20H22O26P2 and a molecular weight of 740.32 g/mol. Its IUPAC name is 1-[4-oxo-4-(1,2,3,4-tetracarboxy-1-phosphonobutoxy)but-2-enoyl]oxy-1-phosphonobutane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1-[4-oxo-4-(1,2,3,4-tetracarboxy-1-phosphonobutoxy)but-2-enoyl]oxy-1-phosphonobutane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 57228678 |
| Molecular Formula | C20H22O26P2 |
| Molecular Weight | 740.32 g/mol |
| Exact Mass | 739.99 |
| IUPAC Name | 1-[4-oxo-4-(1,2,3,4-tetracarboxy-1-phosphonobutoxy)but-2-enoyl]oxy-1-phosphonobutane-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)CC(C(=O)O)C(C(=O)O)C(OC(=O)C=CC(=O)OC(C(=O)O)(C(C(=O)O)C(CC(=O)O)C(=O)O)P(=O)(O)O)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C20H22O26P2/c21-7(22)3-5(13(27)28)11(15(31)32)19(17(35)36,47(39,40)41)45-9(25)1-2-10(26)46-20(18(37)38,48(42,43)44)12(16(33)34)6(14(29)30)4-8(23)24/h1-2,5-6,11-12H,3-4H2,(H,21,22)(H,23,24)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H2,39,40,41)(H2,42,43,44) |
| InChIKey | PPKUGSXNEFYRMQ-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 466.06 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.32 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|