C14H18O8 — CID 175301084
4-prop-2-enylhept-6-ene-1,2,3,4-tetracarboxylic acid (PubChem CID 175301084) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-prop-2-enylhept-6-ene-1,2,3,4-tetracarboxylic acid.
| Compound Name | 4-prop-2-enylhept-6-ene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 175301084 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-prop-2-enylhept-6-ene-1,2,3,4-tetracarboxylic acid |
| SMILES | C=CCC(CC=C)(C(=O)O)C(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18O8/c1-3-5-14(6-4-2,13(21)22)10(12(19)20)8(11(17)18)7-9(15)16/h3-4,8,10H,1-2,5-7H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | HXPHQWNYMPBJKU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|