C16H34N4O2 — CID 57228760
N-[4-[2-[2-(2,2-dimethylpropanoylamino)ethyl]hydrazinyl]butyl]-2,2-dimethylpropanamide (PubChem CID 57228760) has the molecular formula C16H34N4O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-dimethylpropanoylamino)ethyl]hydrazinyl]butyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[2-[2-(2,2-dimethylpropanoylamino)ethyl]hydrazinyl]butyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 57228760 |
| Molecular Formula | C16H34N4O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N-[4-[2-[2-(2,2-dimethylpropanoylamino)ethyl]hydrazinyl]butyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCCNNCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H34N4O2/c1-15(2,3)13(21)17-9-7-8-10-19-20-12-11-18-14(22)16(4,5)6/h19-20H,7-12H2,1-6H3,(H,17,21)(H,18,22) |
| InChIKey | CVQXAXXYFWURSM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|