C14H29N3O2 — CID 167513233
N-[2,2-dimethyl-4-(2-propanoylhydrazinyl)butyl]-2,2-dimethylpropanamide (PubChem CID 167513233) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[2,2-dimethyl-4-(2-propanoylhydrazinyl)butyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2,2-dimethyl-4-(2-propanoylhydrazinyl)butyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 167513233 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[2,2-dimethyl-4-(2-propanoylhydrazinyl)butyl]-2,2-dimethylpropanamide |
| SMILES | CCC(=O)NNCCC(C)(C)CNC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H29N3O2/c1-7-11(18)17-16-9-8-14(5,6)10-15-12(19)13(2,3)4/h16H,7-10H2,1-6H3,(H,15,19)(H,17,18) |
| InChIKey | WVNOKRFSLVMCFO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|