C23H30N4O4S — CID 57229238
(4S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide (PubChem CID 57229238) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is (4S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide.
| Compound Name | (4S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 57229238 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (4S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide |
| SMILES | COc1ccc(C[C@H](NC(=O)c2cccc3c2OCC[C@@H]3N(N)CCCS)C(N)=O)cc1 |
| InChI | InChI=1S/C23H30N4O4S/c1-30-16-8-6-15(7-9-16)14-19(22(24)28)26-23(29)18-5-2-4-17-20(10-12-31-21(17)18)27(25)11-3-13-32/h2,4-9,19-20,32H,3,10-14,25H2,1H3,(H2,24,28)(H,26,29)/t19-,20-/m0/s1 |
| InChIKey | HPBOBVRYBSMTSU-PMACEKPBSA-N |
| XLogP | 1.84 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|