C22H28N4O3S — CID 57295528
(4S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide (PubChem CID 57295528) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is (4S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide.
| Compound Name | (4S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 57295528 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (4S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-4-[amino(3-sulfanylpropyl)amino]-3,4-dihydro-2H-chromene-8-carboxamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc2c1OCC[C@@H]2N(N)CCCS |
| InChI | InChI=1S/C22H28N4O3S/c23-21(27)18(14-15-6-2-1-3-7-15)25-22(28)17-9-4-8-16-19(10-12-29-20(16)17)26(24)11-5-13-30/h1-4,6-9,18-19,30H,5,10-14,24H2,(H2,23,27)(H,25,28)/t18-,19-/m0/s1 |
| InChIKey | NPSXWSBJOVQNKV-OALUTQOASA-N |
| XLogP | 1.83 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|