C46H49FN4O5S — CID 57293495
tert-butyl N-[[(4S)-8-[[(2S)-1-amino-3-(4-fluorophenyl)-1-oxopropan-2-yl]carbamoyl]-3,4-dihydro-2H-chromen-4-yl]-(3-tritylsulfanylpropyl)amino]carbamate (PubChem CID 57293495) has the molecular formula C46H49FN4O5S and a molecular weight of 788.99 g/mol. Its IUPAC name is tert-butyl N-[[(4S)-8-[[(2S)-1-amino-3-(4-fluorophenyl)-1-oxopropan-2-yl]carbamoyl]-3,4-dihydro-2H-chromen-4-yl]-(3-tritylsulfanylpropyl)amino]carbamate.
| Compound Name | tert-butyl N-[[(4S)-8-[[(2S)-1-amino-3-(4-fluorophenyl)-1-oxopropan-2-yl]carbamoyl]-3,4-dihydro-2H-chromen-4-yl]-(3-tritylsulfanylpropyl)amino]carbamate |
|---|---|
| PubChem CID | 57293495 |
| Molecular Formula | C46H49FN4O5S |
| Molecular Weight | 788.99 g/mol |
| Exact Mass | 788.34 |
| IUPAC Name | tert-butyl N-[[(4S)-8-[[(2S)-1-amino-3-(4-fluorophenyl)-1-oxopropan-2-yl]carbamoyl]-3,4-dihydro-2H-chromen-4-yl]-(3-tritylsulfanylpropyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1CCOc2c(C(=O)N[C@@H](Cc3ccc(F)cc3)C(N)=O)cccc21 |
| InChI | InChI=1S/C46H49FN4O5S/c1-45(2,3)56-44(54)50-51(28-14-30-57-46(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35)40-27-29-55-41-37(40)21-13-22-38(41)43(53)49-39(42(48)52)31-32-23-25-36(47)26-24-32/h4-13,15-26,39-40H,14,27-31H2,1-3H3,(H2,48,52)(H,49,53)(H,50,54)/t39-,40-/m0/s1 |
| InChIKey | FHJLVIIWOXVBPI-ZAQUEYBZSA-N |
| XLogP | 8.33 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.99 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|