C11H18O5P+ — CID 57229879
1,3-dihydroxypropyl-(2,6-dimethylphenoxy)-dihydroxyphosphanium (PubChem CID 57229879) has the molecular formula C11H18O5P+ and a molecular weight of 261.23 g/mol. Its IUPAC name is 1,3-dihydroxypropyl-(2,6-dimethylphenoxy)-dihydroxyphosphanium.
| Compound Name | 1,3-dihydroxypropyl-(2,6-dimethylphenoxy)-dihydroxyphosphanium |
|---|---|
| PubChem CID | 57229879 |
| Molecular Formula | C11H18O5P+ |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1,3-dihydroxypropyl-(2,6-dimethylphenoxy)-dihydroxyphosphanium |
| SMILES | Cc1cccc(C)c1O[P+](O)(O)C(O)CCO |
| InChI | InChI=1S/C11H18O5P/c1-8-4-3-5-9(2)11(8)16-17(14,15)10(13)6-7-12/h3-5,10,12-15H,6-7H2,1-2H3/q+1 |
| InChIKey | ZSLJHBYYPAZTDU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|