C32H36O4P2PdS4-2 — CID 6395773
bis(bis(2,6-dimethylphenoxy)-disulfidophosphanium);palladium (PubChem CID 6395773) has the molecular formula C32H36O4P2PdS4-2 and a molecular weight of 781.27 g/mol. Its IUPAC name is bis(bis(2,6-dimethylphenoxy)-disulfidophosphanium);palladium.
| Compound Name | bis(bis(2,6-dimethylphenoxy)-disulfidophosphanium);palladium |
|---|---|
| PubChem CID | 6395773 |
| Molecular Formula | C32H36O4P2PdS4-2 |
| Molecular Weight | 781.27 g/mol |
| Exact Mass | 780.00 |
| IUPAC Name | bis(bis(2,6-dimethylphenoxy)-disulfidophosphanium);palladium |
| SMILES | Cc1cccc(C)c1O[P+]([S-])([S-])Oc1c(C)cccc1C.Cc1cccc(C)c1O[P+]([S-])([S-])Oc1c(C)cccc1C.[Pd] |
| InChI | InChI=1S/2C16H19O2PS2.Pd/c2*1-11-7-5-8-12(2)15(11)17-19(20,21)18-16-13(3)9-6-10-14(16)4;/h2*5-10H,1-4H3,(H,20,21);/p-2 |
| InChIKey | FFHIRWQBFDHRSS-UHFFFAOYSA-L |
| XLogP | 10.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.27 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|