C16H18NaO3PS — CID 101310875
sodium 1-[(2,3-dimethylphenoxy)-oxido-sulfidophosphaniumyl]oxy-2,3-dimethylbenzene (PubChem CID 101310875) has the molecular formula C16H18NaO3PS and a molecular weight of 344.35 g/mol. Its IUPAC name is sodium 1-[(2,3-dimethylphenoxy)-oxido-sulfidophosphaniumyl]oxy-2,3-dimethylbenzene.
| Compound Name | sodium 1-[(2,3-dimethylphenoxy)-oxido-sulfidophosphaniumyl]oxy-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 101310875 |
| Molecular Formula | C16H18NaO3PS |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | sodium 1-[(2,3-dimethylphenoxy)-oxido-sulfidophosphaniumyl]oxy-2,3-dimethylbenzene |
| SMILES | Cc1cccc(O[P+]([O-])([S-])Oc2cccc(C)c2C)c1C.[Na+] |
| InChI | InChI=1S/C16H19O3PS.Na/c1-11-7-5-9-15(13(11)3)18-20(17,21)19-16-10-6-8-12(2)14(16)4;/h5-10H,1-4H3,(H,17,21);/q;+1/p-1 |
| InChIKey | DMAAYCPYFNIROG-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|