C21H31ClN2O2 — CID 57230357
1-(4-chlorophenyl)-6-methyl-N-(3-morpholin-4-ylpropoxy)hepta-1,3-dien-3-amine (PubChem CID 57230357) has the molecular formula C21H31ClN2O2 and a molecular weight of 378.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-methyl-N-(3-morpholin-4-ylpropoxy)hepta-1,3-dien-3-amine.
| Compound Name | 1-(4-chlorophenyl)-6-methyl-N-(3-morpholin-4-ylpropoxy)hepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 57230357 |
| Molecular Formula | C21H31ClN2O2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-(4-chlorophenyl)-6-methyl-N-(3-morpholin-4-ylpropoxy)hepta-1,3-dien-3-amine |
| SMILES | CC(C)CC=C(C=Cc1ccc(Cl)cc1)NOCCCN1CCOCC1 |
| InChI | InChI=1S/C21H31ClN2O2/c1-18(2)4-10-21(11-7-19-5-8-20(22)9-6-19)23-26-15-3-12-24-13-16-25-17-14-24/h5-11,18,23H,3-4,12-17H2,1-2H3 |
| InChIKey | ASZLFLUJEHLXEL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|