C14H22O3 — CID 57233376
2-(4-ethyl-2-oxo-3-pentylcyclopent-3-en-1-yl)acetic acid (PubChem CID 57233376) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxo-3-pentylcyclopent-3-en-1-yl)acetic acid.
| Compound Name | 2-(4-ethyl-2-oxo-3-pentylcyclopent-3-en-1-yl)acetic acid |
|---|---|
| PubChem CID | 57233376 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-(4-ethyl-2-oxo-3-pentylcyclopent-3-en-1-yl)acetic acid |
| SMILES | CCCCCC1=C(CC)CC(CC(=O)O)C1=O |
| InChI | InChI=1S/C14H22O3/c1-3-5-6-7-12-10(4-2)8-11(14(12)17)9-13(15)16/h11H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | XSXOEJSEWRRKQX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|