C13H11Cl2N3OS — CID 57234689
1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)-1-sulfanylurea (PubChem CID 57234689) has the molecular formula C13H11Cl2N3OS and a molecular weight of 328.22 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)-1-sulfanylurea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 57234689 |
| Molecular Formula | C13H11Cl2N3OS |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)-1-sulfanylurea |
| SMILES | Cc1ccc(Cl)cc1N(S)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H11Cl2N3OS/c1-8-2-3-9(14)6-11(8)18(20)13(19)17-12-5-4-10(15)7-16-12/h2-7,20H,1H3,(H,16,17,19) |
| InChIKey | ODOZGSDOKUSXFO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|