C19H21BrN2O4 — CID 57235599
2-bromoethyl-[3-[ethyl-(2-methylphenyl)carbamoyl]oxyphenyl]carbamic acid (PubChem CID 57235599) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 2-bromoethyl-[3-[ethyl-(2-methylphenyl)carbamoyl]oxyphenyl]carbamic acid.
| Compound Name | 2-bromoethyl-[3-[ethyl-(2-methylphenyl)carbamoyl]oxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 57235599 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-bromoethyl-[3-[ethyl-(2-methylphenyl)carbamoyl]oxyphenyl]carbamic acid |
| SMILES | CCN(C(=O)Oc1cccc(N(CCBr)C(=O)O)c1)c1ccccc1C |
| InChI | InChI=1S/C19H21BrN2O4/c1-3-21(17-10-5-4-7-14(17)2)19(25)26-16-9-6-8-15(13-16)22(12-11-20)18(23)24/h4-10,13H,3,11-12H2,1-2H3,(H,23,24) |
| InChIKey | HTEIMLCAXBVUPM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|