C12H18NO2S- — CID 57235644
5-(benzylamino)pentane-2-sulfinate (PubChem CID 57235644) has the molecular formula C12H18NO2S- and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-(benzylamino)pentane-2-sulfinate.
| Compound Name | 5-(benzylamino)pentane-2-sulfinate |
|---|---|
| PubChem CID | 57235644 |
| Molecular Formula | C12H18NO2S- |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-(benzylamino)pentane-2-sulfinate |
| SMILES | CC(CCCNCc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C12H19NO2S/c1-11(16(14)15)6-5-9-13-10-12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3,(H,14,15)/p-1 |
| InChIKey | OKOSOIAVEGJQQF-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|