C21H33N5O3S — CID 57238464
N-[2-(4-amino-N-ethylanilino)ethyl]-N'-[4-(ethylamino)phenyl]-N'-(2-hydroxyethyl)methanesulfonohydrazide (PubChem CID 57238464) has the molecular formula C21H33N5O3S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[2-(4-amino-N-ethylanilino)ethyl]-N'-[4-(ethylamino)phenyl]-N'-(2-hydroxyethyl)methanesulfonohydrazide.
| Compound Name | N-[2-(4-amino-N-ethylanilino)ethyl]-N'-[4-(ethylamino)phenyl]-N'-(2-hydroxyethyl)methanesulfonohydrazide |
|---|---|
| PubChem CID | 57238464 |
| Molecular Formula | C21H33N5O3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[2-(4-amino-N-ethylanilino)ethyl]-N'-[4-(ethylamino)phenyl]-N'-(2-hydroxyethyl)methanesulfonohydrazide |
| SMILES | CCNc1ccc(N(CCO)N(CCN(CC)c2ccc(N)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H33N5O3S/c1-4-23-19-8-12-21(13-9-19)25(16-17-27)26(30(3,28)29)15-14-24(5-2)20-10-6-18(22)7-11-20/h6-13,23,27H,4-5,14-17,22H2,1-3H3 |
| InChIKey | CYDBHBCEZDEOAG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|