C11H23Cl2N3O3S — CID 70452511
2-(4-amino-N-ethylanilino)ethanol;methanesulfonamide;dihydrochloride (PubChem CID 70452511) has the molecular formula C11H23Cl2N3O3S and a molecular weight of 348.30 g/mol. Its IUPAC name is 2-(4-amino-N-ethylanilino)ethanol;methanesulfonamide;dihydrochloride.
| Compound Name | 2-(4-amino-N-ethylanilino)ethanol;methanesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 70452511 |
| Molecular Formula | C11H23Cl2N3O3S |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-(4-amino-N-ethylanilino)ethanol;methanesulfonamide;dihydrochloride |
| SMILES | CCN(CCO)c1ccc(N)cc1.CS(N)(=O)=O.Cl.Cl |
| InChI | InChI=1S/C10H16N2O.CH5NO2S.2ClH/c1-2-12(7-8-13)10-5-3-9(11)4-6-10;1-5(2,3)4;;/h3-6,13H,2,7-8,11H2,1H3;1H3,(H2,2,3,4);2*1H |
| InChIKey | ODUUPYAZQUJIPA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|