C34H38FN3O10 — CID 57238590
[4-[3-(dimethylamino)-2-fluoro-6-(methoxymethoxy)benzoyl]benzoyl] 3-[[4-(methoxymethoxy)benzoyl]amino]azepane-1-carboperoxoate (PubChem CID 57238590) has the molecular formula C34H38FN3O10 and a molecular weight of 667.69 g/mol. Its IUPAC name is [4-[3-(dimethylamino)-2-fluoro-6-(methoxymethoxy)benzoyl]benzoyl] 3-[[4-(methoxymethoxy)benzoyl]amino]azepane-1-carboperoxoate.
| Compound Name | [4-[3-(dimethylamino)-2-fluoro-6-(methoxymethoxy)benzoyl]benzoyl] 3-[[4-(methoxymethoxy)benzoyl]amino]azepane-1-carboperoxoate |
|---|---|
| PubChem CID | 57238590 |
| Molecular Formula | C34H38FN3O10 |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | [4-[3-(dimethylamino)-2-fluoro-6-(methoxymethoxy)benzoyl]benzoyl] 3-[[4-(methoxymethoxy)benzoyl]amino]azepane-1-carboperoxoate |
| SMILES | COCOc1ccc(C(=O)NC2CCCCN(C(=O)OOC(=O)c3ccc(C(=O)c4c(OCOC)ccc(N(C)C)c4F)cc3)C2)cc1 |
| InChI | InChI=1S/C34H38FN3O10/c1-37(2)27-16-17-28(46-21-44-4)29(30(27)35)31(39)22-8-10-24(11-9-22)33(41)47-48-34(42)38-18-6-5-7-25(19-38)36-32(40)23-12-14-26(15-13-23)45-20-43-3/h8-17,25H,5-7,18-21H2,1-4H3,(H,36,40) |
| InChIKey | ARYSVNXENQSMIR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|