C27H33FN2O7 — CID 142582959
tert-butyl 3-[[4-[6-(ethoxymethoxy)-2-fluoro-3-methoxybenzoyl]benzoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 142582959) has the molecular formula C27H33FN2O7 and a molecular weight of 516.57 g/mol. Its IUPAC name is tert-butyl 3-[[4-[6-(ethoxymethoxy)-2-fluoro-3-methoxybenzoyl]benzoyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[6-(ethoxymethoxy)-2-fluoro-3-methoxybenzoyl]benzoyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142582959 |
| Molecular Formula | C27H33FN2O7 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | tert-butyl 3-[[4-[6-(ethoxymethoxy)-2-fluoro-3-methoxybenzoyl]benzoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CCOCOc1ccc(OC)c(F)c1C(=O)c1ccc(C(=O)NC2CCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C27H33FN2O7/c1-6-35-16-36-20-11-12-21(34-5)23(28)22(20)24(31)17-7-9-18(10-8-17)25(32)29-19-13-14-30(15-19)26(33)37-27(2,3)4/h7-12,19H,6,13-16H2,1-5H3,(H,29,32) |
| InChIKey | OSIZBZNYARYYBR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|