C42H52FN3O10 — CID 54021122
tert-butyl (3R,4R)-4-[4-[2-fluoro-6-(methoxymethoxy)-3-pyrrolidin-1-ylbenzoyl]benzoyl]oxy-3-[[4-(methoxymethoxy)-3,5-dimethylbenzoyl]amino]azepane-1-carboxylate (PubChem CID 54021122) has the molecular formula C42H52FN3O10 and a molecular weight of 777.89 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-[4-[2-fluoro-6-(methoxymethoxy)-3-pyrrolidin-1-ylbenzoyl]benzoyl]oxy-3-[[4-(methoxymethoxy)-3,5-dimethylbenzoyl]amino]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-[4-[2-fluoro-6-(methoxymethoxy)-3-pyrrolidin-1-ylbenzoyl]benzoyl]oxy-3-[[4-(methoxymethoxy)-3,5-dimethylbenzoyl]amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 54021122 |
| Molecular Formula | C42H52FN3O10 |
| Molecular Weight | 777.89 g/mol |
| Exact Mass | 777.36 |
| IUPAC Name | tert-butyl (3R,4R)-4-[4-[2-fluoro-6-(methoxymethoxy)-3-pyrrolidin-1-ylbenzoyl]benzoyl]oxy-3-[[4-(methoxymethoxy)-3,5-dimethylbenzoyl]amino]azepane-1-carboxylate |
| SMILES | COCOc1ccc(N2CCCC2)c(F)c1C(=O)c1ccc(C(=O)O[C@@H]2CCCN(C(=O)OC(C)(C)C)C[C@H]2NC(=O)c2cc(C)c(OCOC)c(C)c2)cc1 |
| InChI | InChI=1S/C42H52FN3O10/c1-26-21-30(22-27(2)38(26)54-25-52-7)39(48)44-31-23-46(41(50)56-42(3,4)5)20-10-11-33(31)55-40(49)29-14-12-28(13-15-29)37(47)35-34(53-24-51-6)17-16-32(36(35)43)45-18-8-9-19-45/h12-17,21-22,31,33H,8-11,18-20,23-25H2,1-7H3,(H,44,48)/t31-,33-/m1/s1 |
| InChIKey | KYZGPNPMCZYHIZ-ZQWAWDFXSA-N |
| XLogP | 6.59 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.89 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|