C21H32N2O8 — CID 70285444
tert-butyl [(3R,4R)-4-hydroxy-3-[[3-methoxy-4-(methoxymethoxy)benzoyl]amino]azepan-1-yl] carbonate (PubChem CID 70285444) has the molecular formula C21H32N2O8 and a molecular weight of 440.49 g/mol. Its IUPAC name is tert-butyl [(3R,4R)-4-hydroxy-3-[[3-methoxy-4-(methoxymethoxy)benzoyl]amino]azepan-1-yl] carbonate.
| Compound Name | tert-butyl [(3R,4R)-4-hydroxy-3-[[3-methoxy-4-(methoxymethoxy)benzoyl]amino]azepan-1-yl] carbonate |
|---|---|
| PubChem CID | 70285444 |
| Molecular Formula | C21H32N2O8 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | tert-butyl [(3R,4R)-4-hydroxy-3-[[3-methoxy-4-(methoxymethoxy)benzoyl]amino]azepan-1-yl] carbonate |
| SMILES | COCOc1ccc(C(=O)N[C@@H]2CN(OC(=O)OC(C)(C)C)CCC[C@H]2O)cc1OC |
| InChI | InChI=1S/C21H32N2O8/c1-21(2,3)30-20(26)31-23-10-6-7-16(24)15(12-23)22-19(25)14-8-9-17(29-13-27-4)18(11-14)28-5/h8-9,11,15-16,24H,6-7,10,12-13H2,1-5H3,(H,22,25)/t15-,16-/m1/s1 |
| InChIKey | IOQGARCGVZDQDB-HZPDHXFCSA-N |
| XLogP | 2.10 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|