C15H20ClN5O — CID 57240940
1-[3-(3-chloro-2-pyridinyl)propyl]-3-(N'-cyclopent-3-en-1-ylcarbamimidoyl)urea (PubChem CID 57240940) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[3-(3-chloro-2-pyridinyl)propyl]-3-(N'-cyclopent-3-en-1-ylcarbamimidoyl)urea.
| Compound Name | 1-[3-(3-chloro-2-pyridinyl)propyl]-3-(N'-cyclopent-3-en-1-ylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 57240940 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[3-(3-chloro-2-pyridinyl)propyl]-3-(N'-cyclopent-3-en-1-ylcarbamimidoyl)urea |
| SMILES | N/C(=N\C1CC=CC1)NC(=O)NCCCc1ncccc1Cl |
| InChI | InChI=1S/C15H20ClN5O/c16-12-7-3-9-18-13(12)8-4-10-19-15(22)21-14(17)20-11-5-1-2-6-11/h1-3,7,9,11H,4-6,8,10H2,(H4,17,19,20,21,22) |
| InChIKey | IMQATIVOARFEPL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|